loading
Phthaloyl amlodipine is a medication that belongs to the class of drugs known as calcium channel blockers. It is primarily used to treat hypertension (high blood pressure) and angina pectoris (chest pain). The drug works by inhibiting the influx of calcium ions into the cardiac and smooth muscle cells, which helps to relax the muscles and improve blood flow.

Mechanism of Action
Phthaloyl amlodipine exerts its effects by selectively blocking the L-type calcium channels in the cardiac and smooth muscle cells. By inhibiting the influx of calcium ions, phthaloyl amlodipine prevents the contraction of these muscles, leading to vasodilation and a reduction in blood pressure. This mechanism helps to improve blood flow and reduce the workload on the heart, alleviating symptoms of hypertension and angina pectoris.
Indications
It is commonly prescribed for the management of hypertension (high blood pressure) and angina pectoris (chest pain). In some cases, it may also be used off-label for other conditions under close medical supervision.
| English name: | Phthaloyl Amlodipine |
| English alias: | Amlodipine intermediate; 3-Ethyl-5-methyl-4-(2-Chlorophenyl)-2-(2-phthalimidoethoxl)-methyl-6-methyl-1,4-dihydropyridine-3,5-Dicarboxylate; 3-ethyl 5-methyl 4-(2-chlorophenyl)-2-{[2-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)ethoxy]methyl}-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate; 3-Ethyl-5-methyl-4-(2-Chlorophenyl)-2-(2-phthalimidoethoxy)methyl-6-Methyl-1,4-Dihydro-Pyridine-3,5-Didarboxylate |
| CAS Number: | 88150-62-3 |
| EINECS Number: | 413-410-3 |
| Molecular formula: | C28H27CIN2O7 |
| Molecular weight: | 538.9762 |
| InChI: | InChI=1/C28H27ClN2O7/c1-4-38-28(35)24-21(15-37-14-13-31-25(32)17-9-5-6-10-18(17)26(31)33)30-16(2)22(27(34)36-3)23(24)19-11-7-8-12-20(19)29/h5-12,23,30H,4,13-15H2,1-3H3 |
| Density: | 1.321g/cm3 |
| Boiling point: | 654.061°C at 760 mmHg |
| Flash point: | 349.364°C |
| Steam pressure: | 0mmHg at 25°C |
content is empty!