loading
Amlodipine base is the active pharmaceutical ingredient (API) of amlodipine, a medication that belongs to the class of drugs known as calcium channel blockers. It is primarily used to treat hypertension (high blood pressure) and angina pectoris (chest pain). The drug works by inhibiting the influx of calcium ions into the cardiac and smooth muscle cells, which helps to relax the muscles and improve blood flow.

Mechanism of Action
Amlodipine base exerts its effects by selectively blocking the L-type calcium channels in the cardiac and smooth muscle cells. By inhibiting the influx of calcium ions, amlodipine base prevents the contraction of these muscles, leading to vasodilation and a reduction in blood pressure. This mechanism helps to improve blood flow and reduce the workload on the heart, alleviating symptoms of hypertension and angina pectoris.
Indications
It is commonly prescribed for the management of hypertension (high blood pressure) and angina pectoris (chest pain). In some cases, it may also be used off-label for other conditions under close medical supervision.
| English name: | Amlodipine Base |
| English alias: | Methyl ethyl 2-(2-aminoethoxymethyl)-4-(2-chlorophenyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate; amlodipine |
| CAS Number: | 88150-42-9 |
| EINECS Number: | 1308068-626-2 |
| Molecular formula: | C20H25ClN2O5 |
| Molecular weight: | 408.88 |
| InChI: | InChI=1/C20H25ClN2O5/c1-4-28-20(25)18-15(11-27-10-9-22)23-12(2)16(19(24)26-3)17(18)13-7-5-6-8-14(13)21/h5-8,17,23H,4,9-11,22H2,1-3H3 |
| Density: | 1.227±0.06 g/cm3(Predicted) |
| Melting point: | 178-179℃ |
| Boiling point: | 527.2±50.0 °C(Predicted) |
| Water solubility: | 75.3 mg/L |
content is empty!