close
Choose Your Site
Global
Social Media
2-(2-Ethoxyphenoxy)ethyl bromide is a chemical compound that belongs to the class of alkylating agents. It has been studied for its potential pharmacological properties, although it is not commonly used in clinical practice. The drug works by alkylating DNA and other cellular macromolecules, which can inhibit cell proliferation and induce cell death.
Mechanism of Action
2-(2-Ethoxyphenoxy)ethyl bromide exerts its effects by alkylating DNA and other cellular macromolecules, leading to the formation of interstrand and intrastrand crosslinks. These modifications can disrupt the normal functioning of DNA and other cellular processes, ultimately inhibiting cell proliferation and inducing cell death. This mechanism makes the compound potentially useful in treating cancer and other diseases characterized by abnormal cell growth.
Indications
While 2-(2-Ethoxyphenoxy)ethyl bromide has shown potential anticancer activity in laboratory studies, it is not currently approved for clinical use. Further research is needed to determine its efficacy and safety in treating cancer and other diseases.
| English name: | 2-(2-Ethoxyphenoxy)ethyl bromide |
| English alias: | 2-(2-ethoxyphenoxy)bromide ethane; 5-(2-oxypropyl)-2-methoxybenzene sulphonamide; 1-(2-bromoethoxy)-2-ethoxybenzene; 2-(2-ethoxyphenoxy) bromide ethane |
| CAS Number: | 3259-03-8 |
| EINECS Number: | 608-759-5 |
| Molecular formula: | C10H13BrO2 |
| Molecular weight: | 245.113 |
| InChI: | InChI=1/C10H13BrO2/c1-2-12-9-5-3-4-6-10(9)13-8-7-11/h3-6H,2,7-8H2,1H3 |
| Density: | 1.334g/cm3 |
| Boiling point: | 286.9°C at 760 mmHg |
| Flash point: | 119.2°C |
| Steam pressure: | 0.00442mmHg at 25°C |
